Einecs 236-382-2
2,6-Dimethyl-4-nitrosophenol
CAS: 13331-93-6
Molecular Formula: C8H9NO2
Einecs 236-382-2 - Names and Identifiers
| Name | 2,6-Dimethyl-4-nitrosophenol |
| Synonyms | NSC 73813 AI3-19038 Nsc 73813 Ai3-19038 Einecs 236-382-2 4-Nitroso-2,6-xylenol 2,6-Xylenol, 4-nitroso- 2,6-dimethyl-4-nitroso-pheno 2,6-Dimethyl-p-nitrosophenol 2,6-Dimethyl-4-nitrosophenol Phenol, 2,6-dimethyl-4-nitroso- 2,6-DIMETHYLBENZOQUINONE 4-OXIME |
| CAS | 13331-93-6 |
| EINECS | 236-382-2 |
| InChI | InChI=1/C8H9NO2/c1-5-3-7(9-11)4-6(2)8(5)10/h3-4,10H,1-2H3 |
Einecs 236-382-2 - Physico-chemical Properties
| Molecular Formula | C8H9NO2 |
| Molar Mass | 151.16 |
| Density | 1.16g/cm3 |
| Melting Point | 166-171°C |
| Boling Point | 310°C at 760 mmHg |
| Flash Point | 141.3°C |
| Vapor Presure | 0.000337mmHg at 25°C |
| Refractive Index | 1.546 |
| Physical and Chemical Properties | Yellow crystals. Melting point 166-171 °c. |
Einecs 236-382-2 - Reference Information
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |
Last Update：2024-04-10 22:29:15
